CAS 3430-30-6

3,5-Dibromo-2-hydrazinyl-4-methylpyridine

Description:

3,5-Dibromo-2-hydrazinyl-4-methylpyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2, 4, and 5 positions. The presence of two bromine atoms at the 3 and 5 positions contributes to its reactivity and potential applications in various chemical reactions. The hydrazinyl group at the 2 position introduces a nitrogen-rich functionality, making it a candidate for further derivatization and potential use in pharmaceuticals or agrochemicals. The methyl group at the 4 position adds to the compound's steric and electronic properties, influencing its solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of nitrogen and bromine atoms. Its synthesis and handling require careful consideration of safety protocols due to the reactivity of the bromine substituents and the potential toxicity associated with hydrazine derivatives. Overall, 3,5-Dibromo-2-hydrazinyl-4-methylpyridine is a versatile compound with potential applications in synthetic chemistry and material science.

Formula: C₆H₇Br₂N₃

InChI: InChI=1S/C6H7Br2N3/c1-3-4(7)2-10-6(11-9)5(3)8/h2H,9H2,1H3,(H,10,11)

InChI key: InChIKey=VGQAZPVUPOHCPC-UHFFFAOYSA-N

SMILES: N(N)=C1C(Br)=C(C)C(Br)=CN1

Synonyms:

• 3,5-Dibromo-2-hydrazinyl-4-methylpyridine
• 3,5-Dibromo-2-hydrazino-4-methylpyridine
• 4-Picoline, 3,5-dibromo-2-hydrazino-
• (3,5-Dibromo-4-methylpyridin-2-yl)hydrazine
• Pyridine, 3,5-dibromo-2-hydrazinyl-4-methyl-