CymitQuimica logo

CAS 356530-65-9

:

1-(3-methylphenyl)-N-(tetrahydrofuran-2-ylmethyl)methanamine

Description:
1-(3-methylphenyl)-N-(tetrahydrofuran-2-ylmethyl)methanamine, with the CAS number 356530-65-9, is an organic compound characterized by its complex structure, which includes a methanamine group attached to a 3-methylphenyl moiety and a tetrahydrofuran substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the tetrahydrofuran ring contributes to its potential as a solvent or a stabilizing agent in chemical reactions. Additionally, the aromatic ring may impart unique electronic properties, affecting its reactivity and interaction with other chemical species. The compound's specific applications can vary, but it may be relevant in medicinal chemistry or materials science due to its structural features. Overall, its characteristics are defined by the interplay of its functional groups, which dictate its chemical behavior and potential uses in various fields.
Formula:C13H19NO
InChI:InChI=1/C13H19NO/c1-11-4-2-5-12(8-11)9-14-10-13-6-3-7-15-13/h2,4-5,8,13-14H,3,6-7,9-10H2,1H3
SMILES:Cc1cccc(c1)CNCC1CCCO1
Synonyms:
  • 2-Furanmethanamine, tetrahydro-N-[(3-methylphenyl)methyl]-
  • N-(3-methylbenzyl)-N-(tetrahydrofuran-2-ylmethyl)amine
  • 1-(3-Methylphenyl)-N-(tetrahydrofuran-2-ylmethyl)methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.