CAS 36318-59-9

N-(3-chloro-2-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine

Description:

N-(3-chloro-2-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a chloro substituent on the aromatic ring enhances its reactivity and potential biological activity. This compound features a secondary amine, which can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The thiazole moiety is known for its presence in various pharmacologically active compounds, suggesting potential applications in medicinal chemistry. The molecular structure indicates that it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chloro and methyl groups, which may affect its overall chemical behavior in different environments. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁ClN₂S

InChI: InChI=1/C10H11ClN2S/c1-7-8(11)3-2-4-9(7)13-10-12-5-6-14-10/h2-4H,5-6H2,1H3,(H,12,13)

SMILES: Cc1c(cccc1NC1=NCCS1)Cl

Synonyms:

• (3-Chloro-2-methyl-phenyl)-(4,5-dihydro-thiazol-2-yl)-amine
• 2-thiazolamine, N-(3-chloro-2-methylphenyl)-4,5-dihydro-
• N-(3-Chloro-2-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine

N-(3-Chloro-2-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine

CAS: 36318-59-9

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂S

Purity: Min. 95%

Molecular weight: 226.73 g/mol

Ref: 3D-LBA31859