CymitQuimica logo

CAS 363571-47-5

:

N-(3-methylphenyl)-N-(methylsulfonyl)glycine

Description:
N-(3-methylphenyl)-N-(methylsulfonyl)glycine, with the CAS number 363571-47-5, is an organic compound characterized by its unique structure that includes a glycine backbone substituted with a 3-methylphenyl group and a methylsulfonyl group. This compound typically exhibits properties associated with amino acids, such as being polar and potentially soluble in water due to the presence of the amino and sulfonyl functional groups. The methylsulfonyl group contributes to its stability and may influence its reactivity and interactions with biological systems. The presence of the aromatic 3-methylphenyl moiety can impart hydrophobic characteristics, affecting its solubility and biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would be subject to investigation to determine its potential applications.
Formula:C10H13NO4S
InChI:InChI=1/C10H13NO4S/c1-8-4-3-5-9(6-8)11(7-10(12)13)16(2,14)15/h3-6H,7H2,1-2H3,(H,12,13)
SMILES:Cc1cccc(c1)N(CC(=O)O)S(=O)(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.