CAS 36724-68-2
:(S)-(-)-N-(trifluoroacetyl)prolyl chlor-ide
Description:
(S)-(-)-N-(trifluoroacetyl)prolyl chloride, with the CAS number 36724-68-2, is a chemical compound that belongs to the class of amino acid derivatives. It features a proline backbone, which is an important amino acid in protein synthesis, modified by the presence of a trifluoroacetyl group and a chloride substituent. This compound is characterized by its chirality, as indicated by the (S)- designation, which refers to the specific spatial arrangement of its atoms. The trifluoroacetyl group enhances its reactivity and solubility in organic solvents, making it useful in various synthetic applications, particularly in peptide synthesis and drug development. The presence of the chloride atom can facilitate nucleophilic substitution reactions, further expanding its utility in organic synthesis. Additionally, due to the trifluoromethyl group, this compound may exhibit unique electronic properties, influencing its interactions in biological systems. Overall, (S)-(-)-N-(trifluoroacetyl)prolyl chloride is a valuable intermediate in the field of medicinal chemistry and organic synthesis.
Formula:C7H7ClF3NO2
InChI:InChI=1/C7H7ClF3NO2/c8-5(13)4-2-1-3-12(4)6(14)7(9,10)11/h4H,1-3H2/t4-/m0/s1
SMILES:C1C[C@@H](C(=O)Cl)N(C1)C(=O)C(F)(F)F
Synonyms:- (S)-()-N-(Trifluoroacetyl)prolyl chloride
- 1-(trifluoroacetyl)-L-prolyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-1-(2,2,2-Trifluoroacetyl)pyrrolidine-2-carbonyl chloride
CAS:Formula:C7H7ClF3NO2Purity:≥95%Color and Shape:liquidMolecular weight:229.58Ref: BD-BD42648
100mgTo inquire(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl chloride
CAS:Formula:C7H7ClF3NO2Molecular weight:229.5842(S)-(-)-N-(Trifluoroacetyl)pyrrolidine-2-carbonyl chloride, 0.1M in methylene chloride
CAS:(S)-(-)-N-(Trifluoroacetyl)Prolyl Chloride is a chemical compound that has been shown to inhibit the ion channel TRPC2 in human heart cells. The compound is a prodrug and is metabolized by esterases to the active form, pentafluoroproprionyl chloride. This active form then inhibits the sodium-potassium pump, which leads to an increase in intracellular calcium and cell death. (S)-(-)-N-(Trifluoroacetyl)Prolyl Chloride may be used as a potential treatment for congestive heart failure. It has also been shown to be effective in treating methamphetamine dependence, with a single dose of 50 mg being sufficient to suppress withdrawal symptoms for up to 12 hours. (S)-(-)-N-(Trifluoroacetyl)Prolyl Chloride is not detectable in urine samples after 24 hours and has no detectable effect on liver function testsFormula:C7H7ClF3NO2Purity:Min. 95%Molecular weight:229.58 g/mol


