CAS 3685-22-1
:cis-4-hydroxycyclohexanecarboxylic acid
Description:
Cis-4-hydroxycyclohexanecarboxylic acid, with the CAS number 3685-22-1, is an organic compound characterized by its cyclohexane ring structure, which features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) at the 4-position. This compound is a stereoisomer, specifically the cis form, meaning that the hydroxyl and carboxylic acid groups are on the same side of the cyclohexane ring. It is typically a white crystalline solid and is soluble in water due to the presence of the polar hydroxyl and carboxylic acid functional groups. The compound exhibits typical acid-base behavior, being able to donate a proton from the carboxylic acid group. Its structural features contribute to its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the hydroxyl group can influence its reactivity and interactions with other molecules, making it of interest in various chemical research fields.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6+
Synonyms:- Cyclohexanecarboxylic Acid, 4-Hydroxy-, Cis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
cis-4-Hydroxycyclohexanecarboxylic Acid
CAS:Formula:C7H12O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:144.17Cis-4-hydroxycyclohexanecarboxylic acid
CAS:Cis-4-hydroxycyclohexanecarboxylic acidPurity:97%Molecular weight:144.17g/moltrans-4-Hydroxycyclohexanecarboxylic Acid
CAS:Controlled ProductApplications RANS-4-HYDROXYCYCLOHEXANECARBOXYLICACID (cas# 3685-22-1) is a useful research chemical.
Formula:C7H12O3Color and Shape:NeatMolecular weight:144.17cis-4-Hydroxycyclohexanecarboxylic acid
CAS:Cis-4-Hydroxycyclohexanecarboxylic acid is a metabolite of p-hydroxybenzoic acid. It is the major metabolite in the urine of rats treated with exogenous p-hydroxybenzoic acid. Cis-4-Hydroxycyclohexanecarboxylic acid can be synthesized from glucose and malonic acid, which are its precursors. It has been found to have immunosuppressive activities in rat hepatocytes, as well as metabolic disorders that are related to hyperglycemia or diabetes mellitus. The biosynthesis and metabolic profile of cis-4-Hydroxycyclohexane carboxylic acid can be determined by ultraperformance liquid chromatography (UPLC) with an ion trap mass spectrometer (ITMS).Formula:C7H12O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:144.17 g/mol





