CAS 37267-86-0
:metaphosphoric acid
Description:
Metaphosphoric acid, with the CAS number 37267-86-0, is a polymeric form of phosphoric acid, typically represented by the formula HPO3. It is characterized by its glassy, white solid appearance and is known for its hygroscopic nature, meaning it can absorb moisture from the air. Metaphosphoric acid is soluble in water, forming a solution that exhibits acidic properties. It is often used in analytical chemistry, particularly in the determination of certain metal ions and as a reagent in various chemical reactions. The substance is also known for its ability to act as a dehydrating agent and can participate in condensation reactions. In terms of safety, metaphosphoric acid can be corrosive and should be handled with care, using appropriate personal protective equipment. Its unique properties make it valuable in both industrial applications and laboratory settings, particularly in the synthesis of phosphates and as a stabilizing agent in various formulations.
Formula:C8H19O8P
InChI:InChI=1/C8H16O4.H3O4P/c1-5-9-6(2)11-8(4)12-7(3)10-5;1-5(2,3)4/h5-8H,1-4H3;(H3,1,2,3,4)
SMILES:CC1OC(C)OC(C)OC(C)O1.OP(=O)(O)O
Synonyms:- Meta-phosphoric acid
- Phosphoric acid meta
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Metaphosphoric acid, 39-43%, bal. NaPO{3} (Stabilizer)
CAS:Metaphosphoric acid is used as a dehydrating agent. Its derivative, sodium hexametaphosphate is used as a sequestrant and a food additive. It is also used as a phosphorylating agent, analytical reagent and in dental cements. This Thermo Scientific Chemicals brand product was originally part of the
Formula:H3O9P3Color and Shape:Clear translucent or glassy, lumps or rodsMolecular weight:239.94Metaphosphoric acid, ACS, 33.5-36.5%, bal. NaPO{3} (Stablizer)
CAS:trimetaphosphoric acid magnesium (2:3) salt trimetaphosphoric acid trisodium salt trimetaphosphoric acid magnesium trimetaphosphate calcium trimetaphosphate trimetaphosphoric acid tripotassium salt metaphosphoric acid ruthenium (+3) salt trimetaphosphoric acid trimetaphosphoric acid ruthenium (+3) salt trimetaphosphoric acid magnesium (2:3) saltFormula:H3O9P3Molecular weight:239.94


