CAS 374-99-2: 2,2,3,3,4,4,4-Heptafluorobutylamine
Description:2,2,3,3,4,4,4-Heptafluorobutylamine, with the CAS number 374-99-2, is a fluorinated organic compound characterized by its unique structure, which includes a butylamine backbone substituted with seven fluorine atoms. This compound is typically a colorless liquid at room temperature and is known for its high volatility and low surface tension. The presence of multiple fluorine atoms imparts significant chemical stability and resistance to degradation, making it useful in various applications, including as a solvent and in the synthesis of fluorinated materials. Its high electronegativity contributes to its strong hydrogen bonding capabilities, which can influence its reactivity and interactions with other substances. Additionally, 2,2,3,3,4,4,4-Heptafluorobutylamine is considered to have low toxicity, but safety precautions should still be taken when handling it due to potential environmental impacts associated with fluorinated compounds. Overall, its unique properties make it a subject of interest in both industrial and research settings.
Formula:C4H4F7N
InChI:InChI=1S/C4H4F7N/c5-2(6,1-12)3(7,8)4(9,10)11/h1,12H2
InChI key:InChIKey=WBGBQSRNXPVFDB-UHFFFAOYSA-N
SMILES:FC(F)(F)C(F)(F)C(F)(F)CN
- Synonyms:
- 1-Butanamine, 2,2,3,3,4,4,4-heptafluoro-
- 1H,1H-Heptafluorobutylamine
- 2,2,3,3,4,4,4-Heptafluoro-1-butanamine
- 2,2,3,3,4,4,4-Heptafluorobutan-1-Amine
- 2,2,3,3,4,4,4-Heptafluorobutan-1-Aminium
- Butylamine, 2,2,3,3,4,4,4-heptafluoro-
- 2,2,3,3,4,4,4-Heptafluorobutylamine
