CymitQuimica logo

CAS 374790-91-7

:

(R)-N-(3-Pentyl)-1-phenylethylamine hydrochloride

Description:
(R)-N-(3-Pentyl)-1-phenylethylamine hydrochloride is a chiral amine characterized by its specific stereochemistry, indicated by the (R) configuration. This compound features a phenylethylamine backbone, which is a common structure in various biological systems and pharmaceuticals. The presence of a pentyl group at the nitrogen atom contributes to its hydrophobic characteristics, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its usability in various applications, including research and potential therapeutic uses. The compound may exhibit biological activity, possibly interacting with neurotransmitter systems, given the structural similarities to other amines involved in neurotransmission. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions of synthesis and storage. Overall, (R)-N-(3-Pentyl)-1-phenylethylamine hydrochloride represents a compound of interest in medicinal chemistry and pharmacology due to its structural features and potential biological relevance.
Formula:C13H21N
InChI:InChI=1/C13H21N/c1-4-13(5-2)14-11(3)12-9-7-6-8-10-12/h6-11,13-14H,4-5H2,1-3H3/t11-/m1/s1
SMILES:CCC(CC)N[C@H](C)c1ccccc1
Synonyms:
  • (R)-N-(1-Ethylpropyl)-1-phenylethylamine hydrochloride
  • N-[(1R)-1-phenylethyl]pentan-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.