CAS 37682-75-0
:Valylarginine
Description:
Valylarginine is a dipeptide composed of the amino acids valine and arginine, linked by a peptide bond. It is classified as a basic peptide due to the presence of the positively charged guanidinium group in arginine. Valylarginine is known for its potential biological activities, including roles in protein synthesis and cellular signaling. The substance is soluble in water, which is typical for peptides, and it may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. Valylarginine can be synthesized through solid-phase peptide synthesis or extracted from natural sources. Its structure allows it to participate in various biochemical processes, making it of interest in fields such as biochemistry and pharmacology. Additionally, it may have implications in nutrition and health, particularly in relation to muscle metabolism and immune function. As with many peptides, its properties can be influenced by modifications or the presence of other molecules in a biological system.
Formula:C11H23N5O3
InChI:InChI=1S/C11H23N5O3/c1-6(2)8(12)9(17)16-7(10(18)19)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1
InChI key:InChIKey=IBIDRSSEHFLGSD-YUMQZZPRSA-N
SMILES:[C@H](NC([C@H](C(C)C)N)=O)(CCCNC(=N)N)C(O)=O
Synonyms:- L-Arginine, N2-L-valyl-
- L-Valyl-L-arginine
- L-Arginine, L-valyl-
- N2-L-Valyl-L-arginine
- Arginine, N2-L-valyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Val-Arg-OH
CAS:A salt taste-enhancing dipeptide.Formula:C11H23N5O3Purity:> 99%Color and Shape:White PowderMolecular weight:273.34H-Val-Arg-Oh
CAS:Controlled ProductApplications H-VAL-ARG-OH (cas# 37682-75-0) is a useful research chemical.
Formula:C11H23N5O3Color and Shape:NeatMolecular weight:273.332H-Val-Arg-OH
CAS:H-Val-Arg-OH is a peptide that has been shown to have anti-tumor and immunomodulatory activities. It has been found to stimulate the immune system by inducing tumor cell death and inhibiting tumor growth in mice. H-Val-Arg-OH is also able to inhibit the proliferation of human leukocytes and induce their apoptosis, as well as inhibit the proliferation of tumor cells. H-Val-Arg-OH also binds to nucleotides, which may be responsible for its immunomodulatory activity.Formula:C11H23N5O3Purity:Min. 95%Molecular weight:273.33 g/mol


