CAS 38183-04-9
:6,7-Dihydroxyflavone
Description:
6,7-Dihydroxyflavone is a flavonoid compound characterized by its two hydroxyl groups located at the 6 and 7 positions of the flavone backbone. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and neuroprotective properties. It exhibits a yellow to orange color, typical of flavonoids, and is soluble in organic solvents but has limited solubility in water. The presence of hydroxyl groups enhances its reactivity and ability to form hydrogen bonds, contributing to its biological activity. 6,7-Dihydroxyflavone has been studied for its potential therapeutic effects, particularly in neurodegenerative diseases, due to its ability to modulate signaling pathways and protect neuronal cells from oxidative stress. Additionally, it may influence various physiological processes, making it a subject of interest in pharmacological research. Its chemical structure allows for various modifications, which can lead to derivatives with enhanced properties or activities. Overall, 6,7-Dihydroxyflavone represents a significant compound in the field of natural products and medicinal chemistry.
Formula:C15H10O4
InChI:InChI=1S/C15H10O4/c16-11-7-14(9-4-2-1-3-5-9)19-15-8-13(18)12(17)6-10(11)15/h1-8,17-18H
InChI key:InChIKey=GSAOUZGPXSGVRS-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=CC=C3)=CC(O)=C(O)C2
Synonyms:- 4H-1-benzopyran-4-one, 6,7-dihydroxy-2-phenyl-
- 6,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one
- 6,7-Dihydroxy-2-phenyl-4H-chromen-4-on
- 6,7-Dihydroxyflavone
- Abt 1841
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6,7-Dihydroxyflavone
CAS:6,7-Dihydroxyflavone is a natural product for research related to life sciences. The catalog number is TN3148 and the CAS number is 38183-04-9.Formula:C15H10O4Purity:98%Color and Shape:SolidMolecular weight:254.246,7-Dihydroxyflavone
CAS:<p>6,7-Dihydroxyflavone is a small molecule flavonoid compound, which is a synthetic product derived to mimic naturally occurring substances. This compound is primarily sourced from the metabolic pathways involved in the biosynthesis of flavonoids, which are naturally found in plants. The mode of action of 6,7-Dihydroxyflavone involves the selective activation of the TrkB receptor, mimicking the action of the brain-derived neurotrophic factor (BDNF). This receptor plays a crucial role in neuronal survival, differentiation, and synaptic plasticity.</p>Formula:C15H10O4Purity:Min. 95 Area-%Color and Shape:Yellow PowderMolecular weight:254.24 g/mol6,7-Dihydroxyflavone
CAS:Controlled Product<p>Applications 6,7-Dihydroxyflavone (cas# 38183-04-9) is a useful research chemical.<br></p>Formula:C15H10O4Color and Shape:NeatMolecular weight:254.24


