CAS 38236-46-3
:Mono-N-dealkyldisopyramide
Description:
Mono-N-dealkyldisopyramide, identified by its CAS number 38236-46-3, is a chemical compound that belongs to the class of antiarrhythmic agents. It is a derivative of disopyramide, which is primarily used in the treatment of certain types of cardiac arrhythmias. The "mono-N-dealkyl" designation indicates that the compound has undergone a modification where one of the alkyl groups has been removed, potentially altering its pharmacological properties and efficacy. This compound typically exhibits characteristics such as a moderate to high lipophilicity, which influences its absorption and distribution in biological systems. Additionally, it may possess a specific mechanism of action that involves the blockade of sodium channels in cardiac tissues, thereby stabilizing the cardiac membrane and reducing excitability. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the presence of functional groups. As with many pharmaceuticals, safety and efficacy profiles are critical, and any therapeutic use would require thorough clinical evaluation.
Formula:C18H23N3O
InChI:InChI=1S/C18H23N3O/c1-14(2)20-13-11-18(17(19)22,15-8-4-3-5-9-15)16-10-6-7-12-21-16/h3-10,12,14,20H,11,13H2,1-2H3,(H2,19,22)
InChI key:InChIKey=UWNSWIXIVDMCHZ-UHFFFAOYSA-N
SMILES:C(CCNC(C)C)(C(N)=O)(C1=CC=CC=C1)C2=CC=CC=N2
Synonyms:- (±)-Mono-N-desisopropyldisopyramide
- 2-Phenyl-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide
- 2-Pyridineacetamide, Alpha-[2-[(1-Methylethyl)Amino]Ethyl]-Alpha-Phenyl-
- 2-Pyridineacetamide, α-[2-[(1-methylethyl)amino]ethyl]-α-phenyl-
- 4-(Isopropylamino)-2-phenyl-2-(pyridin-2-yl)butanamide
- 4-Isopropylamino-2-phenyl-2-(2-pyridyl)butyramide
- Mono-N-dealkyldisopyramide
- N-De(isopropyl)disopyramide
- Sc 24566
- α-[2-[(1-Methylethyl)amino]ethyl]-α-phenyl-2-pyridineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
