CAS 406190-09-8

[(2-methylphenyl)amino](oxo)acetic acid

Description:

The chemical substance known as "[(2-methylphenyl)amino](oxo)acetic acid," with the CAS number 406190-09-8, is an organic compound that features both amino and carboxylic acid functional groups. It is characterized by the presence of a 2-methylphenyl group, which contributes to its aromatic properties and may influence its solubility and reactivity. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound is likely to exhibit moderate polarity due to the combination of hydrophilic (carboxylic acid) and hydrophobic (aromatic) regions, affecting its interactions with solvents and biological systems. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which can enhance its solubility in polar solvents. Overall, the unique structural features of this compound may confer specific biological activities or applications in pharmaceuticals or agrochemicals, although detailed studies would be necessary to elucidate its full profile.

Formula: C₉H₉NO₃

InChI: InChI=1/C9H9NO3/c1-6-4-2-3-5-7(6)10-8(11)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)

SMILES: Cc1ccccc1NC(=O)C(=O)O

Synonyms:

• Acetic Acid, 2-[(2-Methylphenyl)Amino]-2-Oxo-
• N-o-Tolyl-oxalamic acid

[(2-Methylphenyl)amino](oxo)acetic acid

CAS: 406190-09-8

Formula: C₉H₉NO₃

Molecular weight: 179.1727

Ref: IN-DA00C8JI

[(2-methylphenyl)amino](oxo)acetic acid

CAS: 406190-09-8

Formula: C₉H₉NO₃

Purity: 95.0%

Molecular weight: 179.175

Ref: 10-F310488