CAS 41359-72-2
:2-(diethylamino)ethyl tetrahydro-alpha-(2-naphthylmethyl)furan-2-propionate
Description:
2-(Diethylamino)ethyl tetrahydro-alpha-(2-naphthylmethyl)furan-2-propionate, with the CAS number 41359-72-2, is a chemical compound that belongs to the class of furan derivatives. It features a tetrahydrofuran ring, which contributes to its cyclic structure and potential reactivity. The presence of a diethylamino group suggests that the compound may exhibit basic properties, potentially allowing it to interact with various biological systems. The naphthylmethyl substituent indicates that the compound may possess aromatic characteristics, which can influence its solubility and stability. This compound may be of interest in medicinal chemistry due to its structural complexity and potential pharmacological applications. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Additionally, safety data and handling precautions would be essential for any practical applications, as with many organic compounds, to ensure safe usage in laboratory or industrial settings.
Formula:C24H33NO3
InChI:InChI=1/C24H33NO3/c1-3-25(4-2)13-15-28-24(26)22(18-23-10-7-14-27-23)17-19-11-12-20-8-5-6-9-21(20)16-19/h5-6,8-9,11-12,16,22-23H,3-4,7,10,13-15,17-18H2,1-2H3
InChI key:InChIKey=IEBDTIUHMNLDTC-UHFFFAOYSA-N
SMILES:C(C(CC1CCCO1)C(OCCN(CC)CC)=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- Tetrahydro-α-(2-naphthalenylmethyl)-2-furanpropanoic acid 2-(diethylamino)ethyl ester
- 2-(Diethylamino)ethyl tetrahydro-alpha-(2-naphthylmethyl)furan-2-propionate
- Naftidrofuryl EP Impurity F
- 2-(diethylamino)ethyl tetrahydro-alpha-(2-naphthylmethyl)furan-2-propionate
- 2-(diethylamino)ethyl 3-naphthalen-2-yl-2-(tetrahydrofuran-2-ylmethyl)propanoate
- 2-Furanpropanoic acid, tetrahydro-α-(2-naphthalenylmethyl)-, 2-(diethylamino)ethyl ester
- 2-[(Diethylamino)ethyl 2-[(naphthalen-2-yl)methyl]-3-(tetrahydrofuran-2-yl)propanoate
- 2-(Diethylamino)ethyl tetrahydro-α-(2-naphthalenylmethyl)-2-furanpropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


