CAS 42365-04-8
:triphenylacetaldehyde
Description:
Triphenylacetaldehyde, with the CAS number 42365-04-8, is an organic compound characterized by its structure, which features a central acetaldehyde group (–CHO) attached to three phenyl groups (C6H5). This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. Triphenylacetaldehyde is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds, including pharmaceuticals and fragrances. Its reactivity is influenced by the presence of the aldehyde functional group, which can participate in various chemical reactions, such as condensation and oxidation. Additionally, the presence of the three phenyl rings contributes to its stability and affects its physical properties, such as boiling point and melting point. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C20H16O
InChI:InChI=1/C20H16O/c21-16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H
SMILES:c1ccc(cc1)C(C=O)(c1ccccc1)c1ccccc1
Synonyms:- Benzeneacetaldehyde, .alpha.,.alpha.-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
