
CAS 444791-56-4
:(2-Chloro-3-pyridinyl)[4-(2-hydroxyethyl)-1-piperazinyl]methanone
Description:
The chemical substance known as (2-Chloro-3-pyridinyl)[4-(2-hydroxyethyl)-1-piperazinyl]methanone, with the CAS number 444791-56-4, is characterized by its complex molecular structure, which includes a pyridine ring and a piperazine moiety. This compound features a chloro substituent at the 2-position of the pyridine ring and a hydroxyethyl group attached to the piperazine, contributing to its potential biological activity. It is typically classified as an organic compound and may exhibit properties such as solubility in polar solvents due to the presence of hydroxyl and amine functionalities. The presence of the chloro group can influence its reactivity and interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic applications.
Formula:C12H16ClN3O2
InChI:InChI=1S/C12H16ClN3O2/c13-11-10(2-1-3-14-11)12(18)16-6-4-15(5-7-16)8-9-17/h1-3,17H,4-9H2
InChI key:InChIKey=BNACZUSUOTVJQJ-UHFFFAOYSA-N
SMILES:C(=O)(N1CCN(CCO)CC1)C2=C(Cl)N=CC=C2
Synonyms:- 1-Piperazineethanol, 4-[(2-chloro-3-pyridinyl)carbonyl]-
- (2-Chloro-3-pyridinyl)[4-(2-hydroxyethyl)-1-piperazinyl]methanone
- Methanone, (2-chloro-3-pyridinyl)[4-(2-hydroxyethyl)-1-piperazinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.