CAS 461-56-3
:3-Fluoropropanoic acid
Description:
3-Fluoropropanoic acid is a fluorinated carboxylic acid characterized by the presence of a fluorine atom at the third carbon of a three-carbon propanoic acid chain. Its molecular formula is C3H5FO2, and it features a carboxylic acid functional group (-COOH) that imparts acidic properties. This compound is typically a colorless liquid or solid at room temperature and is known for its moderate solubility in water, which is influenced by the polar nature of the carboxylic acid group. The presence of the fluorine atom can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points. 3-Fluoropropanoic acid is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and agrochemicals. However, it is essential to handle this compound with care, as fluorinated compounds can exhibit unique toxicological profiles and environmental persistence.
Formula:C3H5FO2
InChI:InChI=1S/C3H5FO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)
InChI key:InChIKey=RPFXMKLCYJSYDE-UHFFFAOYSA-N
SMILES:C(C(O)=O)CF
Synonyms:- 3-Fluoropropanoic Acid
- Brn 1740478
- Propanoic acid, 3-fluoro-
- Propionic acid, 3-fluoro-
- beta-Fluoropropionic acid
- β-Fluoropropionic acid
- 3-Fluoropropionic acid
- 3-Fluoropropionic acid
- 4-02-00-00734 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ref: IN-DA00DFP7
1g342.00€5gTo inquire10gTo inquire25gTo inquire50gTo inquire100mg115.00€250mg190.00€3-Fluoropropanoic Acid
CAS:3-Fluoropropanoic acid is a fluorinated carboxylic acid that has been shown to have antibacterial properties. It is a biocompatible polymer that can be used as a pesticide and medicine. 3-Fluoropropanoic acid has biological properties, with the ability to inhibit the synthesis of proteins by enzymatic reactions. It is also able to introduce fluorine into organic molecules, which is useful in synthesizing new medicines. 3-Fluoropropanoic acid can be synthesized by introducing hydrofluoric acid into an erythromycin molecule, which then reacts with intramolecular hydrogen bonds to form the product.Formula:C3H5FO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:92.07 g/mol


