CAS 4933-19-1

5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione

Description:

5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione, with the CAS number 4933-19-1, is a heterocyclic organic compound characterized by its fused pyrrole and pyrazine rings. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in various chemical reactions. The structure of this compound allows for interesting electronic properties and potential biological activity, making it of interest in medicinal chemistry and material science. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents. The presence of nitrogen atoms in its structure can influence its basicity and reactivity, particularly in nucleophilic and electrophilic reactions. Additionally, derivatives of this compound may be synthesized to explore its pharmacological properties or to develop new materials with specific functionalities. Overall, 5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione is a versatile compound with potential applications in various fields of chemistry.

Formula: C₆H₃N₃O₂

InChI: InChI=1/C6H3N3O2/c10-5-3-4(6(11)9-5)8-2-1-7-3/h1-2H,(H,9,10,11)

SMILES: c1cnc2c(C(=NC2=O)O)n1

Synonyms:

• PYRROLO(3,4-B)PYRAZINE,5,7-DIOXO-
• 5H-Pyrrolo[3,4-b]pyrazine-5,7(6H)-dione
• 5H,6H,7H-PYRROLO[3,4-B]PYRAZINE-5,7-DIONE
• PYRAZINE-2,3-DICARBOXYLICACIDIMIDE

5H-Pyrrolo[3,4-b]pyrazine-5,7(6H)-dione

CAS: 4933-19-1

Formula: C₆H₃N₃O₂

Purity: 95.0%

Molecular weight: 149.109

Ref: 10-F438350

5H,6H,7H-Pyrrolo[3,4-b]pyrazine-5,7-dione

CAS: 4933-19-1

Versatile small molecule scaffold

Formula: C₆H₃N₃O₂

Purity: Min. 95%

Molecular weight: 149.11 g/mol

Ref: 3D-EAA93319