CymitQuimica logo

CAS 53221-07-1

:

2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol

Description:
2-(Dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol, identified by its CAS number 53221-07-1, is a chemical compound characterized by its complex structure, which includes a dibutylamino group and a fluorenyl moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in organic solvents and the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the dibutylamino group suggests that it may exhibit basic properties, while the fluorenyl structure can contribute to its stability and potential for aromatic interactions. Additionally, the dichloro substituents on the fluorenyl ring may influence its reactivity and electronic properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential biological activity. However, specific applications and safety considerations would depend on further research and characterization.
Formula:C23H29Cl2NO
InChI:InChI=1/C23H29Cl2NO/c1-3-5-9-26(10-6-4-2)15-22(27)21-14-19(25)13-17-11-16-12-18(24)7-8-20(16)23(17)21/h7-8,12-14,22,27H,3-6,9-11,15H2,1-2H3
Synonyms:
  • 2-(Dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol
  • 9H-fluorene-4-methanol, 2,7-dichloro-alpha-[(dibutylamino)methyl]-
  • Nsc305808
  • 2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol hydrochloride
  • 2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol HCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.