CAS 5323-57-9

quinoline-2,4-dicarboxylic acid

Description:

Quinoline-2,4-dicarboxylic acid is an aromatic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features two carboxylic acid groups (-COOH) located at the 2 and 4 positions of the quinoline ring, contributing to its acidic properties and enhancing its solubility in polar solvents. It typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The presence of the carboxylic acid groups allows for the formation of salts and esters, making it versatile in chemical reactions. Quinoline derivatives are often studied for their biological activities, including antimicrobial and antitumor properties. Additionally, the compound's structure allows for potential coordination with metal ions, which can be useful in catalysis and materials science. Overall, quinoline-2,4-dicarboxylic acid is a significant compound in both synthetic and applied chemistry contexts.

Formula: C₁₁H₇NO₄

InChI: InChI=1/C11H7NO4/c13-10(14)7-5-9(11(15)16)12-8-4-2-1-3-6(7)8/h1-5H,(H,13,14)(H,15,16)

SMILES: c1ccc2c(c1)c(cc(C(=O)O)n2)C(=O)O

Synonyms:

• 2,4-Quinolinedicarboxylic Acid

Quinoline-2,4-dicarboxylic acid

CAS: 5323-57-9

Formula: C₁₁H₇NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.1776

Ref: IN-DA00D8P4

Quinoline-2,4-dicarboxylic acid

CAS: 5323-57-9

Quinoline-2,4-dicarboxylic acid

Purity: 95%

Molecular weight: 217.18g/mol

Ref: 54-OR1066915

Quinoline 2,4-dicarboxylic acid

CAS: 5323-57-9

Quinoline 2,4-dicarboxylic acid (QDA) is a novel cytotoxic agent that targets cervical cancer cells. It inhibits the uptake of glucose and other nutrients by cervical cancer cells, leading to cell death through apoptosis. QDA also inhibits the expression of genes involved in cross-linking reactions, which are important for the structural integrity of proteins. This agent has been shown to inhibit the growth of aniline-induced breast cancer cells and glutamate-stimulated PC12 cells. QDA binds to DNA and forms covalent bonds with nucleotide bases, inhibiting DNA synthesis, as well as interfering with protein synthesis and cell division. The QDA mechanism is similar to that of benzoquinolines and estrone sulfate.

Formula: C₁₁H₇NO₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 217.18 g/mol

Ref: 3D-FQ67149

Quinoline-2,4-dicarboxylic acid

CAS: 5323-57-9

Purity: ≥95%

Molecular weight: 217.1799927

Ref: 10-F723022