CAS 53483-12-8
:α-(1,1-Dimethylethyl)benzenepropanoic acid
Description:
α-(1,1-Dimethylethyl)benzenepropanoic acid, also known as a branched-chain aromatic carboxylic acid, is characterized by its unique structure that includes a benzene ring substituted with a propanoic acid group and a tert-butyl group (1,1-dimethylethyl). This compound typically exhibits properties common to carboxylic acids, such as acidity due to the presence of the carboxyl functional group (-COOH). It is likely to be a solid or viscous liquid at room temperature, depending on its molecular weight and structure. The presence of the bulky tert-butyl group can influence its solubility, making it less soluble in polar solvents while potentially enhancing solubility in non-polar solvents. Additionally, the compound may exhibit moderate to high boiling and melting points relative to simpler carboxylic acids due to increased molecular interactions. Its aromatic nature may also impart stability and influence reactivity, making it of interest in various chemical applications, including synthesis and as a potential intermediate in organic chemistry.
Formula:C13H18O2
InChI:InChI=1S/C13H18O2/c1-13(2,3)11(12(14)15)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,14,15)
InChI key:InChIKey=UKWWMMXKMDNJEM-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(C(C)(C)C)C(O)=O
Synonyms:- 2-Benzyl-3,3-Dimethylbutanoic Acid
- 2-Phenylmethyl-3,3-dimethylbutanoic acid
- 3,3-Dimethyl-2-(phenylmethyl)butanoic acid
- 3,3-Dimethyl-2-benzylbutanoic acid
- Benzenepropanoic acid, α-(1,1-dimethylethyl)-
- Hydrocinnamic acid, α-tert-butyl-
- α-(1,1-Dimethylethyl)benzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
