CAS 54237-72-8: Cimetidine sulfoxide
Description:Cimetidine sulfoxide, with the CAS number 54237-72-8, is a metabolite of the well-known histamine H2-receptor antagonist cimetidine, which is primarily used to reduce stomach acid production. This compound is characterized by the presence of a sulfoxide functional group, which is indicative of its oxidation state. Cimetidine sulfoxide is typically a white to off-white solid, and its molecular structure includes a thiazole ring and an imidazole moiety, which are integral to its pharmacological activity. The sulfoxide group can influence the compound's solubility, stability, and biological activity compared to its parent compound. In terms of its pharmacokinetics, cimetidine sulfoxide may exhibit different absorption, distribution, metabolism, and excretion properties. While cimetidine itself is known for its role in treating conditions like peptic ulcers and gastroesophageal reflux disease, the specific therapeutic implications of cimetidine sulfoxide are less well-documented, warranting further research into its potential effects and applications in clinical settings.
Formula:C10H16N6OS
InChI:InChI=1S/C10H16N6OS/c1-8-9(16-7-15-8)5-18(17)4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14)
InChI key:InChIKey=HOJLJLYVNQFCRE-UHFFFAOYSA-N
SMILES:N#CNC(=NCCS(=O)CC=1NC=NC1C)NC
- Synonyms:
- Guanidine, N-cyano-N′-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]sulfinyl]ethyl]-
- (±)-Cimetidine S-oxide
- N-Cyano-N′-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]sulfinyl]ethyl]guanidine
- Guanidine, N-cyano-N′-methyl-N′′-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]sulfinyl]ethyl]-
- Cimetidine sulfoxide
![2-Cyano-1-methyl-3-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]sulphinyl]ethyl]guanidine (Cimetidine Su…](https://static.cymitquimica.com/products/86/thumb/MM0020.04.jpg)
![N-Cyano-N'-methyl-N''-[2-[(5-methyl-1H-imidazol-4-yl)methylsulphinyl]ethyl]guanidine](https://static.cymitquimica.com/products/3D/thumb/IC58267.jpg)
