CAS 5427-30-5
:P-(3-Aminophenyl)phosphonic acid
Description:
P-(3-Aminophenyl)phosphonic acid, with the CAS number 5427-30-5, is an organophosphorus compound characterized by the presence of a phosphonic acid group attached to a phenyl ring that has an amino substituent in the para position. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the phosphonic acid functional group, which can ionize to form negatively charged species in solution. The amino group can participate in hydrogen bonding and may also act as a site for further chemical modifications. P-(3-Aminophenyl)phosphonic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its reactivity and functional groups allow for diverse synthetic pathways, making it a valuable compound in research and industrial applications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8NO3P
InChI:InChI=1S/C6H8NO3P/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,7H2,(H2,8,9,10)
InChI key:InChIKey=MZZQBSHNCYWSTL-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)C1=CC(N)=CC=C1
Synonyms:- (m-Aminophenyl)phosphonic acid
- 1-Aminobenzene-3-phosphonic acid
- 3-Aminobenzenephosphonic acid
- 3-Phosphonoaniline
- Aniline-3-phosphonic acid
- Brn 2936774
- Nsc 13007
- P-(3-Aminophenyl)phosphonic acid
- Phosphonic acid, (3-aminophenyl)-
- Phosphonic acid, (m-aminophenyl)-
- Phosphonic acid, P-(3-aminophenyl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.