CAS 5431-93-6
:ethyl 2-(acetylamino)-3-oxobutanoate
Description:
Ethyl 2-(acetylamino)-3-oxobutanoate, with the CAS number 5431-93-6, is an organic compound that belongs to the class of esters and amides. It features a butanoate backbone, which is substituted with an acetylamino group and a keto group, contributing to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone, but its solubility in water is limited due to the hydrophobic nature of the butanoate chain. Ethyl 2-(acetylamino)-3-oxobutanoate can participate in various chemical reactions, including acylation and condensation, making it useful in the synthesis of pharmaceuticals and agrochemicals. Its structural features suggest potential biological activity, which may warrant further investigation in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C8H13NO4
InChI:InChI=1/C8H13NO4/c1-4-13-8(12)7(5(2)10)9-6(3)11/h7H,4H2,1-3H3,(H,9,11)
SMILES:CCOC(=O)C(C(=O)C)N=C(C)O
Synonyms:- Butanoic Acid, 2-(Acetylamino)-3-Oxo-, Ethyl Ester
- Ethyl 2-acetamido-3-oxobutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
