CymitQuimica logo

CAS 54610-73-0

:

furan-2-carboximidamide

Description:
Furan-2-carboximidamide, identified by its CAS number 54610-73-0, is an organic compound characterized by the presence of a furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. This compound features a carboximidamide functional group, which consists of a carbon atom double-bonded to a nitrogen atom and single-bonded to an amine group. Furan-2-carboximidamide is typically a white to off-white solid and is soluble in polar solvents. Its structure allows for potential reactivity in various chemical reactions, particularly those involving nucleophiles or electrophiles due to the presence of the imidamide group. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its derivatives could be explored for applications in agrochemicals or materials science. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c6-5(7)4-2-1-3-8-4/h1-3H,(H3,6,7)
SMILES:c1cc(C(=N)N)oc1
Synonyms:
  • 2-Furancarboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.