CAS 554-95-0: 1,3,5-Benzenetricarboxylic acid
Description:1,3,5-Benzenetricarboxylic acid, also known as trimesic acid, is an aromatic carboxylic acid characterized by three carboxyl (-COOH) groups attached to a benzene ring at the 1, 3, and 5 positions. This compound is a white crystalline solid that is soluble in water and organic solvents such as ethanol and acetone. It has a melting point that typically falls within a moderate range, indicating its stability under standard conditions. Trimesic acid is known for its ability to form hydrogen bonds, which contributes to its solid-state properties and potential applications in materials science. It is utilized in the synthesis of polyesters and as a building block in the production of various polymers, including those used in coatings and adhesives. Additionally, its derivatives can be employed in the manufacture of pharmaceuticals and agrochemicals. The compound is generally considered to have low toxicity, but standard safety precautions should be observed when handling it in laboratory settings.
Formula:C9H6O6
InChI:InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)
InChI key:InChIKey=QMKYBPDZANOJGF-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C=C(C1)C(=O)O)C(=O)O
- Synonyms:
- 1,3,5-Tricarboxybenzene
- 1,3,5-Trimesic Acid
- 5-Carboxyisophthalic acid
- Acide benzene-1,3,5-tricarboxylique
- Acido Benceno-1,3,5-Tricarboxilico
- B 0043
- Benzene-1,3,5-Tricarboxylate
- Benzene-1,3,5-Tricarboxylic Acid
- Benzol-1,3,5-tricarbonsaure
- Nsc 3998
- See more synonyms
- Trimesic acid
- Trimesinic acid
- Trimesinsaeure
- Trimesitinic acid
- 1,3,5-Benzenetricarboxylic acid
