CAS 56877-15-7
:[1,3-Dimethyl-5-(methylamino)-1H-pyrazol-4-yl](2-fluorophenyl)methanone
Description:
[1,3-Dimethyl-5-(methylamino)-1H-pyrazol-4-yl](2-fluorophenyl)methanone, with the CAS number 56877-15-7, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a dimethyl substitution at the 1 and 3 positions of the pyrazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a methylamino group at the 5 position may contribute to its reactivity and interaction with biological targets. Additionally, the compound has a 2-fluorophenyl group attached via a methanone linkage, which can affect its electronic properties and steric hindrance. Such structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, including solubility, stability, and reactivity, would be influenced by its functional groups and overall molecular structure, making it a subject of interest for further research in drug design and synthesis.
Formula:C13H14FN3O
InChI:InChI=1S/C13H14FN3O/c1-8-11(13(15-2)17(3)16-8)12(18)9-6-4-5-7-10(9)14/h4-7,15H,1-3H3
InChI key:InChIKey=GJKAEHDZZWMUDS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC)N(C)N=C1C)C2=C(F)C=CC=C2
Synonyms:- 4-(o-Fluorobenzoyl)-1,3-dimethyl-5-(methylamino)pyrazole
- Pd 73093
- methanone, [1,3-dimethyl-5-(methylamino)-1H-pyrazol-4-yl](2-fluorophenyl)-
- [1,3-Dimethyl-5-(methylamino)-1H-pyrazol-4-yl](2-fluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
