CAS 569-06-2
:1-Fluoro-9,10-anthracenedione
Description:
1-Fluoro-9,10-anthracenedione, with the CAS number 569-06-2, is a synthetic organic compound belonging to the class of anthraquinones. It features a fluoro substituent at the 1-position of the anthracenedione structure, which consists of a three-ring aromatic system with two carbonyl groups at the 9 and 10 positions. This compound is characterized by its deep red to brown color and exhibits strong fluorescence, making it useful in various applications, including dyes and pigments. Its molecular structure contributes to its reactivity, particularly in electrophilic substitution reactions. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its stability and solubility in organic solvents. Additionally, 1-fluoro-9,10-anthracenedione may exhibit biological activity, although specific studies on its toxicity and environmental impact are limited. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with chemical exposure.
Formula:C14H7FO2
InChI:InChI=1/C14H7FO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H
InChI key:InChIKey=QFDHYBLCHGMWDI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC=CC2F
Synonyms:- 1-Fluoro-9,10-anthracenedione
- 1-Fluoro-9,10-anthraquinone
- 1-Fluoroanthraquinone
- 9,10-Anthracenedione, 1-Fluoro-
- Anthraquinone, 1-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Fluoroanthraquinone
CAS:Controlled ProductFormula:C14H7FO2Color and Shape:NeatMolecular weight:226.203
