CAS 57078-12-3

Cyclohexanecarboxylic acid, 2-(4-methoxybenzoyl)-, trans-

Description:

Cyclohexanecarboxylic acid, 2-(4-methoxybenzoyl)-, trans- is an organic compound characterized by its cyclohexane ring structure with a carboxylic acid functional group and a 4-methoxybenzoyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The trans configuration indicates that the substituents are positioned on opposite sides of the cyclohexane ring, which can influence its physical properties, such as melting and boiling points, as well as its reactivity in chemical reactions. The methoxy group contributes to the compound's polarity and can affect its interaction with other molecules. Cyclohexanecarboxylic acid derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their ability to participate in various chemical reactions, including esterification and amidation.

Formula: C₁₅H₁₈O₄

InChI: InChI=1/C15H18O4/c1-19-11-8-6-10(7-9-11)14(16)12-4-2-3-5-13(12)15(17)18/h6-9,12-13H,2-5H2,1H3,(H,17,18)/t12-,13-/s2

InChI key: InChIKey=MDVQAVHPOFZFQS-NVHKGDCHNA-N

SMILES: C(=O)([C@H]1[C@H](C(O)=O)CCCC1)C2=CC=C(OC)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 2-(4-methoxybenzoyl)-, trans-