CAS 57319-65-0
:6-Aminophthalide
Description:
6-Aminophthalide is an organic compound characterized by its structure, which features an amino group (-NH2) attached to a phthalide ring system. This compound is typically represented by a bicyclic structure that includes a lactam, which is a cyclic amide. The presence of the amino group imparts basic properties to the molecule, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. 6-Aminophthalide is often utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Its solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. Additionally, the compound's reactivity can be influenced by the electronic effects of substituents on the aromatic ring. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 6-Aminophthalide is a versatile compound with applications in various fields of chemistry.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2
InChI key:InChIKey=ZIJZDNKZJZUROE-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(N)C2)CO1
Synonyms:- 1(3H)-Isobenzofuranone, 6-amino-
- 5-Amino-3-oxo-1,3-dihydroisobenzofuran
- 6-Amino-1(3H)-isobenzofuranone
- 6-Amino-3H-isobenzofuran-1-one
- 6-Aminophtalide
- 6-Aminophthalide
- 6-amino-2-benzofuran-1(3H)-one
- NSC 49585
- Phthalide, 6-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Aminophthalide, 95%
CAS:It is used to produce 6-acetylamino-phthalide. It is also used as a starting material in the reduction reaction. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origina
Formula:C8H7NO2Purity:95%Color and Shape:Powder, Pale cream to cream to yellow to pale brownMolecular weight:149.156-Aminoisobenzofuran-1(3H)-one
CAS:Formula:C8H7NO2Purity:99%Color and Shape:SolidMolecular weight:149.1467Ref: IN-DA00368K
1g56.00€5g126.00€10g174.00€1kgTo inquire25g559.00€50gTo inquire100gTo inquire100mg25.00€250mg28.00€6-Aminophthalide
CAS:6-AminophthalideFormula:C8H7NO2Purity:95Color and Shape:PowderMolecular weight:149.15g/mol6-Amino-2-benzofuran-1(3H)-one
CAS:Formula:C8H7NO2Purity:98%Color and Shape:SolidMolecular weight:149.1496-Aminophthalide
CAS:6-Aminophthalide is a fluorophore that can be used as an indicator of the presence of aldehydes. It is also a fluorescent compound that has been shown to be capable of binding to metal cations, such as Cu(II) and Zn(II). 6-Aminophthalide can be reduced by desoxybenzoin in the presence of amines to give the corresponding amine and 6-aminophthalide. The resulting solid has a crystal structure with one molecule in each asymmetric unit.Formula:C8H7NO2Purity:Min. 95%Molecular weight:149.15 g/mol




