CAS 57865-37-9
:methyl 2-(acetyloxy)-2-methylpropanoate
Description:
Methyl 2-(acetyloxy)-2-methylpropanoate, with the CAS number 57865-37-9, is an ester compound characterized by its functional groups, including an acetate and a methyl ester. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, which is common among esters. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic alkyl groups. The molecular structure features a branched alkyl chain, which contributes to its unique properties, including lower boiling points compared to straight-chain esters. Methyl 2-(acetyloxy)-2-methylpropanoate is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the acetyloxy group, making it susceptible to hydrolysis under certain conditions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H12O4
InChI:InChI=1/C7H12O4/c1-5(8)11-7(2,3)6(9)10-4/h1-4H3
SMILES:CC(=O)OC(C)(C)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
