CymitQuimica logo

CAS 57939-40-9

:

6-Amino-2-(2-propen-1-ylthio)-4(3H)-pyrimidinone

Description:
6-Amino-2-(2-propen-1-ylthio)-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core, which features an amino group at the 6-position and a thioether substituent at the 2-position. The presence of the propenylthio group introduces a degree of reactivity, making it potentially useful in various organic synthesis applications. This compound is likely to exhibit polar characteristics due to the amino and carbonyl functionalities, which can engage in hydrogen bonding. Its structure suggests potential biological activity, possibly as a pharmaceutical agent or a precursor in drug development, given the importance of pyrimidine derivatives in medicinal chemistry. The compound's CAS number, 57939-40-9, allows for easy identification in chemical databases and literature. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions, such as pH and solvent used. Overall, 6-Amino-2-(2-propen-1-ylthio)-4(3H)-pyrimidinone represents a versatile structure with potential applications in various fields of chemistry.
Formula:C7H9N3OS
InChI:InChI=1S/C7H9N3OS/c1-2-3-12-7-9-5(8)4-6(11)10-7/h2,4H,1,3H2,(H3,8,9,10,11)
InChI key:InChIKey=NWUWAZUYYDWUPO-UHFFFAOYSA-N
SMILES:S(CC=C)C=1NC(N)=CC(=O)N1
Synonyms:
  • 2-Allylsulfanyl-6-amino-pyrimidin-4-ol
  • 4(1H)-Pyrimidinone, 6-amino-2-(2-propenylthio)-
  • 6-Amino-2-(2-propen-1-ylthio)-4(3H)-pyrimidinone
  • 2-(Allylthio)-6-aminopyrimidin-4(3H)-one
  • 4(3H)-Pyrimidinone, 6-amino-2-(2-propen-1-ylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.