CAS 591771-83-4

6-Propoxy-3-pyridinemethanamine

Description:

6-Propoxy-3-pyridinemethanamine, with the CAS number 591771-83-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a propoxy group, which is an alkoxy functional group derived from propanol, attached to the sixth position of the pyridine ring. The presence of the amine group (methanamine) indicates that it has basic properties and can participate in hydrogen bonding, making it potentially soluble in polar solvents. The molecular structure suggests that it may exhibit biological activity, possibly interacting with various biological targets due to the presence of both the aromatic and amine functionalities. Its specific applications and reactivity would depend on the context of its use, such as in pharmaceuticals or as a chemical intermediate. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₉H₁₄N₂O

InChI: InChI=1S/C9H14N2O/c1-2-5-12-9-4-3-8(6-10)7-11-9/h3-4,7H,2,5-6,10H2,1H3

InChI key: InChIKey=MZGGIWMWLZNQIX-UHFFFAOYSA-N

SMILES: O(CCC)C1=CC=C(CN)C=N1

Synonyms:

• 6-Propoxy-3-pyridinemethanamine
• 3-Pyridinemethanamine, 6-propoxy-
• (6-Propoxypyridin-3-yl)methanamine

(6-Propoxypyridin-3-yl)methanamine

CAS: 591771-83-4

Versatile small molecule scaffold

Formula: C₉H₁₄N₂O

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-RYA77183