CAS 5994-87-6
:Diphenylphosphinamide
Description:
Diphenylphosphinamide, with the CAS number 5994-87-6, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two phenyl groups and an amine functional group. This compound typically appears as a white to off-white solid and is known for its stability and relatively low volatility. Diphenylphosphinamide exhibits properties that make it useful in various applications, including as a ligand in coordination chemistry and as a reagent in organic synthesis. Its structure allows for potential interactions with metal ions, which can facilitate catalysis or the formation of complex compounds. Additionally, diphenylphosphinamide may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity. Overall, diphenylphosphinamide is a versatile compound with applications in both industrial and research settings, particularly in the fields of coordination chemistry and organic synthesis.
Formula:C12H12NOP
InChI:InChI=1/C12H12NOP/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,13,14)
SMILES:c1ccc(cc1)P(=O)(c1ccccc1)N
Synonyms:- P,P-diphenylphosphinic amide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Diphenylphosphinamide, 98%
CAS:<p>Diphenylphosphinamide is used to furnish 5H-oxazol-4-ones with diastereoselectivity and enantioselectivity. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alf</p>Formula:C12H12NOPPurity:98%Color and Shape:Powder, White to creamMolecular weight:217.21P,P-Diphenylphosphinic amide
CAS:Formula:C12H12NOPPurity:97%Color and Shape:SolidMolecular weight:217.2035P,P-Diphenylphosphinic amide
CAS:Formula:C12H12NOPPurity:97%Color and Shape:SolidMolecular weight:217.208
