CAS 6076-38-6
:2,3-Bis(octadecyloxy)-1-propanol
Description:
2,3-Bis(octadecyloxy)-1-propanol, with the CAS number 6076-38-6, is a chemical compound characterized by its long hydrocarbon chains, which contribute to its amphiphilic nature. This substance features two octadecyloxy groups attached to a propane backbone, making it a type of glycerol ether. Its structure imparts significant hydrophobic properties due to the lengthy alkyl chains, while the hydroxyl groups provide hydrophilicity, allowing it to interact with both polar and non-polar environments. This dual characteristic makes it useful in various applications, including as a surfactant, emulsifier, or stabilizer in formulations. Additionally, its long-chain structure can enhance the viscosity and stability of products, making it valuable in the cosmetic and pharmaceutical industries. The compound is typically solid at room temperature and may exhibit low solubility in water, but it can dissolve in organic solvents. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.
Formula:C39H80O3
InChI:InChI=1S/C39H80O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-38-39(37-40)42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h39-40H,3-38H2,1-2H3
InChI key:InChIKey=QEHCYTDFERPPPU-UHFFFAOYSA-N
SMILES:C(COCCCCCCCCCCCCCCCCCC)(OCCCCCCCCCCCCCCCCCC)CO
Synonyms:- 1,2-O-Dioctadecyl-rac-glycerol
- 1,2-O-Dioctadecylglycerol
- 1-Propanol, 2,3-bis(octadecyloxy)-
- 2,3-Bis(octadecyloxy)-1-propanol
- Glycerine 1,2-distearyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-bis(octadecyloxy)-1-propanol
CAS:Formula:C39H80O3Purity:>98%Color and Shape:SolidMolecular weight:597.051,2-O-Dioctadecyl-rac-glycerol
CAS:Controlled ProductFormula:C39H80O3Color and Shape:NeatMolecular weight:597.0511,2-O-Dioctadecyl-rac-glycerol
CAS:<p>1,2-O-Dioctadecyl-rac-glycerol is a lipid that belongs to the class of synthetic lipids. It has been used as a model system for studying the interactions between phosphatidylcholine (PC) and other lipids. The systematic study of the morphology of 1,2-O-dioctadecyl-rac-glycerol in various solvents revealed that it is an amphiphile with an elongated shape. This molecule interacts with PC membranes in a specific manner, which can be detected using optical measurements. The transition from the solid to liquid state causes 1,2-O-dioctadecyl-rac-glycerol to change its shape from a rod to an ellipsoid. This property can be used as a diagnostic tool for identifying transitions in nanomaterials.</p>Formula:C39H80O3Purity:Min. 95%Molecular weight:597.05 g/mol1,2-O-Dioctadecyl-rac-glycerol
CAS:<p>1,2-O-Dioctadecyl-rac-glycerol, a saturated dialkyl glyceryl ether featuring octadecyl groups at the sn-1 and sn-2 positions, closely resembles the structure of diacylglycerol. This similarity allows its use in model lipid bilayers to explore the dynamics of different biological membrane compositions.</p>Formula:C39H80O3Color and Shape:SolidMolecular weight:597.066




