CAS 6342-75-2

1-(2-methoxy-3-methylphenyl)ethanone

Description:

1-(2-Methoxy-3-methylphenyl)ethanone, also known by its CAS number 6342-75-2, is an organic compound characterized by its ketone functional group and aromatic structure. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a phenyl ring, contributing to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid with a sweet, pleasant odor, which is common among aromatic ketones. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the methoxy group enhances its reactivity and can influence its behavior in various chemical reactions, including electrophilic aromatic substitution. Additionally, this compound may be used in the synthesis of other organic molecules and can serve as a fragrance or flavoring agent in certain applications. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.

Formula: C₁₀H₁₂O₂

InChI: InChI=1/C10H12O2/c1-7-5-4-6-9(8(2)11)10(7)12-3/h4-6H,1-3H3

SMILES: Cc1cccc(C(=O)C)c1OC

2'-Methoxy-3'-methylacetophenone

CAS: 6342-75-2

2'-Methoxy-3'-methylacetophenone

Formula: C₁₀H₁₂O₂

Purity: ≥95%

Color and Shape: clear. colourless liquid

Molecular weight: 164.20g/mol

Ref: 54-OR43670