CAS 63524-04-9
:D-erythro-Hex-2-enonic acid, γ-lactone, sodium salt, hydrate (1:1:1)
Description:
D-erythro-Hex-2-enonic acid, γ-lactone, sodium salt, hydrate (1:1:1) is a chemical compound characterized by its structure as a sodium salt of a lactone derived from a hexenoic acid. This compound typically exhibits properties associated with both organic acids and their corresponding salts, including solubility in water due to the presence of the sodium ion. The lactone form suggests a cyclic ester, which can influence its reactivity and stability. As a hydrate, it contains water molecules in its crystalline structure, which can affect its physical properties such as melting point and solubility. The presence of the D-erythro configuration indicates specific stereochemistry, which can be crucial for biological activity and interactions. This compound may be of interest in various fields, including biochemistry and pharmaceuticals, due to its potential roles in metabolic pathways or as a biochemical reagent. However, specific applications and biological effects would depend on further research and context regarding its use.
Formula:C6H8O6·H2O·Na
InChI:InChI=1S/C6H8O6.Na.H2O/c7-1-2(8)5-3(9)4(10)6(11)12-5;;/h2,5,7-10H,1H2;;1H2/t2-,5-;;/m1../s1
InChI key:InChIKey=WYRHHUCFJGBSPP-DMWQRSMXSA-N
SMILES:[C@H](CO)(O)[C@@]1(C(O)=C(O)C(=O)O1)[H].[Na].O
Synonyms:- <span class="text-smallcaps">D</span>-erythro-Hex-2-enonic acid, γ-lactone, monosodium salt, monohydrate
- <span class="text-smallcaps">D</span>-erythro-Hex-2-enonic acid, γ-lactone, sodium salt, hydrate (1:1:1)
- D(+)-Isoascorbic acid, sodium salt monohydrate
- Sodium erythorbate monohydrate
- [(5R)-5-(1,2-dihydroxyethyl)-4-hydroxy-5-methyl-2-oxo-3-furyl]oxysodium hydrate
- monosodium <span class="text-smallcaps">D</span>-isoascorbate monohydrate
- monosodium D-isoascorbate monohydrate
- D-erythro-Hex-2-enonic acid, γ-lactone, sodium salt, hydrate (1:1:1)
- Erbit N
- D-erythro-Hex-2-enonic acid, γ-lactone, monosodium salt, monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sodium Isoascorbate Monohydrate
CAS:Formula:C6H7NaO6·H2OPurity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:216.13Sodium Erythorbate Monohydrate
CAS:Formula:C6H9NaO7Purity:98%Color and Shape:SolidMolecular weight:216.1212Sodium Isoascorbate Monohydrate
CAS:Sodium Isoascorbate MonohydratePurity:99%Molecular weight:216.12g/molSodium erythorbate hydrate
CAS:<p>Sodium erythorbate hydrate is a white crystalline solid that belongs to the class of organic compounds known as fatty acids. It is used in biological treatment to reduce malic acid and copper complex. The active methylene group in sodium erythorbate hydrate is connected to an alkylthio group, which makes it able to form hydrogen bonds with other molecules. Sodium erythorbate also has a hydrogen bond with anhydrous sodium, which helps it stay stable and prevents decomposition. Sodium erythorbate can be used for wastewater treatment because of its ability to react with active oxygen, forming the corresponding alcohol and oxidizing agent. The intramolecular hydrogen bond between the methylene group and hydroxyl group stabilizes the molecule by reducing its tendency to break down into two separate molecules.</p>Formula:C6H7NaO6·xH2OPurity:Min. 98.5%Color and Shape:PowderMolecular weight:198.11 g/molSodium D-isoascorbate monohydrate
CAS:Formula:C6H9NaO7Purity:≥98%Color and Shape:SolidMolecular weight:216.121




