CAS 64809-67-2
:Neomangiferin
Description:
Neomangiferin is a naturally occurring flavonoid glycoside, primarily derived from the leaves of the mango tree (Mangifera indica) and other plants. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anti-diabetic properties. The chemical structure of neomangiferin consists of a flavonoid backbone with a sugar moiety, which contributes to its solubility and bioactivity. This compound has garnered interest in pharmacological research due to its ability to modulate various biological pathways, making it a candidate for therapeutic applications. Neomangiferin is typically studied in the context of traditional medicine and modern pharmacology, with ongoing investigations into its mechanisms of action and efficacy. Additionally, its safety profile and potential side effects are important considerations for its use in dietary supplements or medicinal formulations. Overall, neomangiferin represents a significant area of interest in natural product chemistry and its applications in health and wellness.
Formula:C25H28O16
InChI:InChI=1S/C25H28O16/c26-4-12-17(31)20(34)22(36)24(39-12)14-8(29)3-11-15(19(14)33)16(30)6-1-10(7(28)2-9(6)38-11)40-25-23(37)21(35)18(32)13(5-27)41-25/h1-3,12-13,17-18,20-29,31-37H,4-5H2/t12-,13-,17-,18-,20+,21+,22-,23-,24+,25-/m1/s1
InChI key:InChIKey=VUWOVGXVRYBSGI-IRXABLMPSA-N
SMILES:OC1=C2C(OC=3C(C2=O)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=C(O)C3)=CC(O)=C1[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O
Synonyms:- 2-β-D-Glucopyranosyl-7-(β-D-glucopyranosyloxy)-1,3,6-trihydroxy-9H-xanthen-9-one
- Neomangiferin
- 9H-Xanthen-9-one, 2-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-1,3,6-trihydroxy-
- 7-O-Glucopyranosylmangiferin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Neomangiferin
CAS:Formula:C25H28O16Purity:≥ 98.0%Color and Shape:Yellow to brown powderMolecular weight:584.48Neomangiferin
CAS:Neomangiferin exhibits antidiabetic and antiosteoporotic actions; it has beneficial effects on high fat diet-induced nonalcoholic fatty liver disease in rats, it also modulates the Th17/Treg balance and ameliorates colitis in mice.Formula:C25H28O16Purity:95%~99%Molecular weight:584.483Neomangiferin
CAS:Neomangiferin combats fatty liver in rats and inhibits an enzyme linked to bone loss.Formula:C25H28O16Purity:99.41% - 99.83%Color and Shape:SolidMolecular weight:584.48Ref: TM-T3804
2mg34.00€5mg49.00€10mg71.00€25mg120.00€50mg170.00€100mg255.00€200mg378.00€1mL*10mM (DMSO)65.00€Neomangiferin
CAS:Natural glycosideFormula:C25H28O16Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:584.49Neomangiferin
CAS:Neomangiferin is a bioactive compound, which is a xanthone glucoside derived from the leaves, bark, or roots of Mangifera indica, commonly known as the mango tree. Its molecular structure enables it to engage in multiple biochemical interactions, primarily through antioxidant, anti-inflammatory, and immunomodulatory mechanisms. The compound's antioxidant properties result from its ability to scavenge free radicals and reduce oxidative stress, while its anti-inflammatory action is associated with the inhibition of key inflammatory mediators.Formula:C25H28O16Purity:Min. 95%Color and Shape:PowderMolecular weight:584.48 g/mol







