CAS 64809-67-2: Neomangiferin
Description:Neomangiferin is a naturally occurring flavonoid glycoside, primarily derived from the leaves of the mango tree (Mangifera indica) and other plants. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anti-diabetic properties. The chemical structure of neomangiferin consists of a flavonoid backbone with a sugar moiety, which contributes to its solubility and bioactivity. This compound has garnered interest in pharmacological research due to its ability to modulate various biological pathways, making it a candidate for therapeutic applications. Neomangiferin is typically studied in the context of traditional medicine and modern pharmacology, with ongoing investigations into its mechanisms of action and efficacy. Additionally, its safety profile and potential side effects are important considerations for its use in dietary supplements or medicinal formulations. Overall, neomangiferin represents a significant area of interest in natural product chemistry and its applications in health and wellness.
Formula:C25H28O16
InChI:InChI=1S/C25H28O16/c26-4-12-17(31)20(34)22(36)24(39-12)14-8(29)3-11-15(19(14)33)16(30)6-1-10(7(28)2-9(6)38-11)40-25-23(37)21(35)18(32)13(5-27)41-25/h1-3,12-13,17-18,20-29,31-37H,4-5H2/t12-,13-,17-,18-,20+,21+,22-,23-,24+,25-/m1/s1
InChI key:InChIKey=VUWOVGXVRYBSGI-IRXABLMPSA-N
SMILES:O=C1C2=CC(OC3OC(CO)C(O)C(O)C3O)=C(O)C=C2OC4=CC(O)=C(C(O)=C14)C5OC(CO)C(O)C(O)C5O
- Synonyms:
- 2-β-D-Glucopyranosyl-7-(β-D-glucopyranosyloxy)-1,3,6-trihydroxy-9H-xanthen-9-one
- Neomangiferin
- 9H-Xanthen-9-one, 2-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-1,3,6-trihydroxy-
- 7-O-Glucopyranosylmangiferin
