CAS 65295-49-0

[3-(4-bromophenoxy)phenyl](cyano)methyl 2-(4-chlorophenyl)-3-methylbutanoate

Description:

The chemical substance "[3-(4-bromophenoxy)phenyl](cyano)methyl 2-(4-chlorophenyl)-3-methylbutanoate," with the CAS number 65295-49-0, is an organic compound characterized by its complex structure, which includes multiple functional groups. It features a cyano group, which is known for its reactivity and ability to participate in various chemical reactions, as well as ester functionality due to the butanoate moiety. The presence of bromine and chlorine substituents on the aromatic rings contributes to its potential biological activity and lipophilicity, which can influence its solubility and interaction with biological systems. This compound may exhibit properties typical of pharmaceuticals or agrochemicals, such as herbicidal or pesticidal activity, owing to its structural characteristics. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect its stability and reactivity. Overall, this compound's unique combination of functional groups and substituents makes it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₂₅H₂₁BrClNO₃

InChI: InChI=1/C25H21BrClNO3/c1-16(2)24(17-6-10-20(27)11-7-17)25(29)31-23(15-28)18-4-3-5-22(14-18)30-21-12-8-19(26)9-13-21/h3-14,16,23-24H,1-2H3

SMILES: CC(C)C(c1ccc(cc1)Cl)C(=O)OC(C#N)c1cccc(c1)Oc1ccc(cc1)Br

(3-(4-bromophenoxy)phenyl)(cyano)methyl 2-(4-chlorophenyl)-3-methylbutanoate

Controlled Product

CAS: 65295-49-0

Applications (3-(4-bromophenoxy)phenyl)(cyano)methyl 2-(4-chlorophenyl)-3-methylbutanoate has been used to study the chemistry of synthetic pyrethroids containing certain secondary alcohol moieties and their insecticidal potential
References Matsuo T., et al., Pestic. Sci., 11, 202-18 (1980)

Formula: C₂₅H₂₁BrClNO₃

Color and Shape: Neat

Molecular weight: 498.796

Ref: TR-B793060