CAS 65767-22-8
:(5Z)-octa-1,5-dien-3-one
Description:
(5Z)-Octa-1,5-dien-3-one, with the CAS number 65767-22-8, is an organic compound characterized by its unique structure featuring a conjugated diene system and a ketone functional group. This compound has a molecular formula that reflects its carbon and hydrogen content, typical of unsaturated ketones. The presence of double bonds in the octa-1,5-dien structure contributes to its reactivity and potential applications in organic synthesis and as a building block in various chemical reactions. The "5Z" designation indicates the specific stereochemistry of the double bond at the fifth position, which can influence the compound's physical and chemical properties, such as boiling point, solubility, and reactivity. Generally, compounds like (5Z)-octa-1,5-dien-3-one may exhibit interesting biological activities, making them of interest in fields such as medicinal chemistry and agrochemicals. Its stability and behavior under different conditions can be further explored through various analytical techniques, including spectroscopy and chromatography.
Formula:C8H12O
InChI:InChI=1/C8H12O/c1-3-5-6-7-8(9)4-2/h4-6H,2-3,7H2,1H3/b6-5-
SMILES:CC/C=C\CC(=O)C=C
Synonyms:- 1,5-octadien-3-one, (5Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(Z)-Octa-1,5-dien-3-one (~0.1% Hydroquinone)
CAS:Controlled ProductStability Volatile
Applications (Z)-Octa-1,5-dien-3-one is an odorant found in green tea, and palm wines.
References Katsuno, T., et. al.: Food Chem., 148, 388 (2014); Lasekan, O.: Molecules, 18, 11809 (2013)Formula:C8H12OPurity:>80%Color and Shape:NeatMolecular weight:124.18(Z)-Octa-1,5-dien-3-one
CAS:Please enquire for more information about (Z)-Octa-1,5-dien-3-one including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H12OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:124.18 g/mol


