CAS 66992-27-6

N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt

Description:

N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt, commonly known as BES, is a zwitterionic buffer widely used in biological and biochemical research. It features a sulfonic acid group, which contributes to its buffering capacity, particularly in the physiological pH range. BES is characterized by its high solubility in water, making it suitable for various aqueous applications. The compound is stable under a range of temperatures and pH levels, which enhances its utility in laboratory settings. Its structure includes two hydroxyethyl groups that provide additional stability and solubility, while the amino group allows for interactions with biomolecules. BES is often employed in cell culture and enzyme assays due to its minimal interference with biological processes. Additionally, it is considered to have low toxicity, making it a safer alternative to some traditional buffers. Overall, BES is valued for its effectiveness in maintaining pH stability in biological systems, contributing to reliable experimental outcomes.

Formula: C₆H₁₄NNaO₅S

InChI: InChI=1/C6H15NO5S.Na/c8-4-1-7(2-5-9)3-6-13(10,11)12;/h8-9H,1-6H2,(H,10,11,12);/q;+1/p-1

SMILES: C(CO)N(CCO)CCS(=O)(=O)O.[Na]

Synonyms:

• BES sodium salt
• Sodium 2-[Bis(2-Hydroxyethyl)Amino]Ethanesulfonate
• 2-[bis(2-Hydroxyethyl)amino]-ethanesulfonic acid sodium salt
• BES-Na

BES sodium salt

CAS: 66992-27-6

Formula: C₆H₁₄NNaO₅S

Purity: 97%

Color and Shape: Solid

Molecular weight: 235.2338

Ref: IN-DA006MZC

BES sodium salt

CAS: 66992-27-6

BES sodium salt is commonly used to prepare buffer solutions with a pH of 6.4-7.8, maintaining a stable pH environment.

Formula: C₆H₁₄NNaO₅S

Color and Shape: Solid

Molecular weight: 235.23

Ref: TM-T65006

N,N-Bis(2-hydroxyethyl)-2-aminoethanesulphonic acid sodium salt

CAS: 66992-27-6

N,N-Bis(2-hydroxyethyl)-2-aminoethanesulphonic acid sodium salt

Purity: 97%

Molecular weight: 235.23g/mol

Ref: 54-BIB1147

BES sodium salt

CAS: 66992-27-6

Formula: C₆H₁₄NNaO₅S

Molecular weight: 235.23

Ref: 7W-GB9133

BES (sodium)

CAS: 66992-27-6

Purity: 97%

Molecular weight: 235.23

Ref: 10-F986720

BES Sodium Salt Buffer extrapure, 99%

CAS: 66992-27-6

Formula: C₆H₁₄NNaO₅S

Purity: min. 99%

Color and Shape: White, Crystalline powder, Clear, Colourless

Molecular weight: 235.23

Ref: SR-59299

BES, sodium salt

CAS: 66992-27-6

Formula: C₆H₁₄NNaO₅S

Purity: 99%

Molecular weight: 235.049

Ref: 10-F463339

N,N-bis(Hydroxyethyl)-2-aminoethanesulfonic acid sodium salt

CAS: 66992-27-6

N,N-bis(Hydroxyethyl)-2-aminoethanesulfonic acid sodium salt is a cross-linking agent for polymers. It has been shown to react with dimethylol propionic acid to form a hydroxyl group and a carboxylate. This reaction yields the product of bis(hydroxyethyl) aminosulfonic acid sodium salt. N,N-bis(Hydroxyethyl)-2-aminoethanesulfonic acid sodium salt can be used as a cross-linking agent in the manufacture of biodegradable polymers that are environmentally friendly and biocompatible. The viscosity of the reaction solution increases with an increase in temperature, which is due to the hydrophobic interaction between molecules.

Formula: C₆H₁₄NO₅SNa

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 235.23 g/mol

Ref: 3D-FB47032