CAS 67508-84-3
:methyl 4-({3-amino-2,3,6-trideoxy-4-O-[2,6-dideoxy-4-O-(6-methyl-5-oxotetrahydro-2H-pyran-2-yl)hexopyranosyl]hexopyranosyl}oxy)-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate
Description:
Methyl 4-({3-amino-2,3,6-trideoxy-4-O-[2,6-dideoxy-4-O-(6-methyl-5-oxotetrahydro-2H-pyran-2-yl)hexopyranosyl]hexopyranosyl}oxy)-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate, with CAS number 67508-84-3, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), amino (-NH2), and carboxylate (-COO-) groups. This compound features a tetracene backbone, which is a polycyclic aromatic hydrocarbon known for its potential electronic and optical properties. The presence of sugar moieties indicates that it may exhibit biological activity, possibly interacting with biological systems or serving as a glycosylated compound. Its solubility, stability, and reactivity would depend on the specific arrangement of its substituents and the overall molecular conformation. Such compounds are often studied for their potential applications in pharmaceuticals, materials science, and biochemistry, particularly in the context of drug delivery or as bioactive agents.
Formula:C40H49NO15
InChI:InChI=1/C40H49NO15/c1-6-40(49)15-26(31-20(33(40)39(48)50-5)12-21-32(36(31)47)35(46)30-19(34(21)45)8-7-9-24(30)43)54-28-13-22(41)37(17(3)52-28)56-29-14-25(44)38(18(4)53-29)55-27-11-10-23(42)16(2)51-27/h7-9,12,16-18,22,25-29,33,37-38,43-44,47,49H,6,10-11,13-15,41H2,1-5H3
Synonyms:- 1-Naphthacenecarboxylic acid, 4-[[3-amino-2,3,6-trideoxy-4-O-[2,6-dideoxy-4-O-[(2R-trans)-tetrahydro-6-methyl-5-oxo-2H-pyran-2-yl]-α-L-lyxo-hexopyranosyl]-α-L-lyxo-hexopyranosyl]oxy]-2-ethyl-1,2,3,4,6,11-hexahydro-2,5,7-trihydroxy-6,11-dioxo-, methyl ester, [1R-(1α,2β,4β)]- (9CI)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Antibiotic MA144 K1
CAS:<p>Antibiotic MA144 K1 is an anthracycline glycoside that functions as a chemotherapeutic agent, inhibiting the growth of malignant tumors and treating infections caused by Gram-positive bacteria.</p>Formula:C40H49NO15Color and Shape:SolidMolecular weight:783.82
