CAS 68156-13-8
:Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate
Description:
Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate is an organosulfonium salt characterized by its unique structure, which includes a sulfonium cation and a hexafluorophosphate anion. The sulfonium cation features a central sulfur atom bonded to two phenyl groups and a phenylthio group, contributing to its stability and reactivity. This compound is typically used as a photoinitiator in polymerization processes, particularly in UV-curable systems, due to its ability to generate reactive species upon exposure to light. The hexafluorophosphate anion enhances the solubility and stability of the compound in various solvents. Additionally, it exhibits good thermal stability, making it suitable for applications in electronic materials and coatings. The presence of multiple aromatic rings in its structure can also impart interesting electronic properties, which may be leveraged in advanced materials science. Overall, Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate is a versatile compound with significant utility in the field of polymer chemistry and materials science.
Formula:C24H19S2·F6P
InChI:InChI=1/C24H19S2.F6P/c1-4-12-20(13-5-1)25-23-18-10-11-19-24(23)26(21-14-6-2-7-15-21)22-16-8-3-9-17-22;1-7(2,3,4,5)6/h1-19H;/q+1;-1
Synonyms:- Diphenyl(4-Phenylthio)Phenylsufonium Hexafluorophosphate
- Diphenyl(4-phenylthio)phenylsulfonium hexafuorophosphate
- Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate
- Diphenyl[2-(Phenylsulfanyl)Phenyl]Sulfonium Hexafluorophosphate
- Phosphate(1-), hexafluoro-, diphenyl[(phenylthio)phenyl]sulfonium
- Sulfonium, diphenyl[(phenylthio)phenyl]-, hexafluorophosphate(1-)
- Sulfonium, diphenyl[(phenylthio)phenyl]-, hexafluorophosphate(1-) (1:1)
- GC 2391
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
CAS:Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphatePurity:≥95%Color and Shape:SolidMolecular weight:516.50g/molDiphenyl[4-(phenylthio)phenyl]sulfonium Hexafluorophosphate (ca. 50% in Propylene Carbonate)
CAS:Formula:C24H19F6PS2Color and Shape:Colorless to Yellow clear liquidMolecular weight:516.50Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
CAS:Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is a photoinitiator that is used in photopolymerization. It absorbs light at around 800 nm and emits light at around 810 nm. The initiator has a low molecular weight and is soluble in organic solvents, which makes it suitable for polymerization of acrylate monomers. Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate can be synthesized by the reaction of diphenyliodonium hexafluorophosphate with phenyldithiocarbonyl chloride.Formula:C24H19S2•PF6Purity:Min. 95%Color and Shape:PowderMolecular weight:516.5 g/mol


