CAS 6879-05-6
:Dehydroeburicoic acid
Description:
Dehydroeburicoic acid is a naturally occurring compound classified as a triterpenoid, primarily derived from the plant species of the genus *Euphorbia*. It is known for its unique chemical structure, which features a pentacyclic framework typical of many triterpenes. This compound exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Dehydroeburicoic acid is often studied for its effects on cellular processes and its potential therapeutic applications. In terms of physical properties, it is typically a solid at room temperature and may exhibit low solubility in water, but it can dissolve in organic solvents. Its molecular formula and structure contribute to its reactivity and interaction with biological systems. As research continues, further insights into its mechanisms of action and potential uses in medicine are anticipated, highlighting the importance of natural products in drug discovery and development.
Formula:C31H48O3
InChI:InChI=1S/C31H48O3/c1-19(2)20(3)9-10-21(27(33)34)22-13-17-31(8)24-11-12-25-28(4,5)26(32)15-16-29(25,6)23(24)14-18-30(22,31)7/h11,14,19,21-22,25-26,32H,3,9-10,12-13,15-18H2,1-2,4-8H3,(H,33,34)/t21-,22-,25+,26+,29-,30-,31+/m1/s1
InChI key:InChIKey=ONFPYGOMAADWAT-OXUZYLMNSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CCC(C(C)C)=C)C(O)=O)(CC2)[H]
Synonyms:- Lanosta-7,9(11)-dien-21-oic acid, 3β-hydroxy-24-methylene-, (20R)-
- Eburicoic acid, dehydro-
- Dehydroeburicoic acid
- Lanosta-7,9(11)-dien-21-oic acid, 3-hydroxy-24-methylene-, (3β)-
- (3β)-3-Hydroxy-24-methylenelanosta-7,9(11)-dien-21-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dehydrotrametenolic acid
CAS:Formula:C31H48O3Purity:99%Color and Shape:SolidMolecular weight:468.7110Dehydroeburicoic acid
CAS:Controlled ProductDehydroeburicoic acid is a natural compound that has been shown to inhibit the growth of cancer cells. It also inhibits the production of alcohols by horse liver, which may be useful in reducing the risk of developing Alzheimer's disease. Dehydroeburicoic acid is a white crystalline powder that has a chemical structure similar to lanostane, which is an inhibitor of phellinus. This compound was isolated from antrodia camphorata, a medicinal mushroom used in traditional Chinese medicine for the treatment of skin conditions and as an antibacterial agent. Dehydroeburicoic acid is also found in other natural products including medicines and healthcare products.Formula:C31H48O3Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:468.71 g/molDehydrotrametenolic acid
CAS:Dehydrotrametenolic acid (Dehydroeburicoic acid) induces necrotic cell death that involves Ca(2+) overload, mitochondrial dysfunction, and calpain activation inFormula:C31H48O3Purity:98%Color and Shape:SolidMolecular weight:468.71




