CAS 6918-15-6

dipyridin-4-ylmethanone

Description:

Dipyridin-4-ylmethanone, also known as 4,4'-bipyridine-1-ylmethanone, is an organic compound characterized by its structure, which features two pyridine rings connected by a methanone group. This compound typically appears as a crystalline solid and is soluble in polar organic solvents. It exhibits properties associated with both the pyridine moiety and the carbonyl group, making it a versatile building block in organic synthesis and coordination chemistry. Dipyridin-4-ylmethanone can participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the electrophilic nature of the carbonyl carbon. Additionally, it can act as a ligand in coordination complexes, interacting with metal ions to form stable complexes. The compound's unique electronic properties, stemming from the conjugation between the pyridine rings and the carbonyl group, contribute to its potential applications in materials science and medicinal chemistry. Overall, dipyridin-4-ylmethanone is a valuable compound in both academic research and industrial applications.

Formula: C₁₁H₈N₂O

InChI: InChI=1/C11H8N2O/c14-11(9-1-5-12-6-2-9)10-3-7-13-8-4-10/h1-8H

SMILES: c1cnccc1C(=O)c1ccncc1

Di(pyridin-4-yl)methanone

CAS: 6918-15-6

Formula: C₁₁H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.1940

Ref: IN-DA005X6P

Di(pyridin-4-yl)methanone

CAS: 6918-15-6

Di(pyridin-4-yl)methanone

Purity: 95%

Molecular weight: 184.2g/mol

Ref: 54-OR1071831

Di(pyridin-4-yl)methanone

CAS: 6918-15-6

Formula: C₁₁H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.198

Ref: 10-F232155

Dipyridin-4-ylmethanone

CAS: 6918-15-6

Dipyridin-4-ylmethanone is a nitrate that has been shown to have thermodynamic, vibrational, and optical properties. Dipyridin-4-ylmethanone can be a synthetic product for the development of new drugs or as an attractant for insects in pest control. It has been shown to have nucleophilic properties by reacting with ethyl bromoacetate. The nitrate reacts with the hydroxyl group on the carbon atom at position 4 of the benzene ring to form a resonance stabilized carbocation intermediate, which then undergoes beta elimination to yield dipyridin-4-ylmethanone. Dipyridin-4-ylmethanone is a crystalline solid with an x-ray crystal structure that has been studied using x-ray crystallography and functional theory methods. The molecule has also been studied using spin resonance spectroscopy, which is able to measure the magnetic moments of atoms

Formula: C₁₁H₈N₂O

Purity: Min. 95%

Molecular weight: 184.19 g/mol

Ref: 3D-GAA91815