CAS 7062-14-8
:N-(4-acetylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Description:
N-(4-acetylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide, with the CAS number 7062-14-8, is a chemical compound characterized by its complex structure, which includes a benzothiophene core fused with a tetrahydro moiety and an amide functional group. This compound features an acetylphenyl substituent, contributing to its potential biological activity. The presence of the benzothiophene ring suggests that it may exhibit properties typical of heterocyclic compounds, such as potential pharmacological effects. The amide group can influence the compound's solubility and reactivity, making it of interest in medicinal chemistry. Additionally, the tetrahydro configuration indicates that the compound is likely to be a saturated derivative, which may affect its stability and interaction with biological targets. Overall, this compound's unique structural features may render it useful in various applications, particularly in drug development and research into therapeutic agents.
Formula:C17H17NO2S
InChI:InChI=1/C17H17NO2S/c1-11(19)12-6-8-13(9-7-12)18-17(20)15-10-21-16-5-3-2-4-14(15)16/h6-10H,2-5H2,1H3,(H,18,20)
SMILES:CC(=O)c1ccc(cc1)NC(=O)c1csc2CCCCc12
Synonyms:- benzo[b]thiophene-3-carboxamide, N-(4-acetylphenyl)-4,5,6,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.