CAS 71830-07-4
:(1S,3R)-3-Aminocyclopentanecarboxylic acid
Description:
(1S,3R)-3-Aminocyclopentanecarboxylic acid, with the CAS number 71830-07-4, is a cyclic amino acid characterized by its unique structural features. It contains a cyclopentane ring with an amino group and a carboxylic acid functional group, which contribute to its properties as a chiral compound. The specific stereochemistry indicated by the (1S,3R) configuration suggests that it has distinct spatial arrangements, influencing its biological activity and interactions. This compound is typically soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. Its amino group can also participate in various chemical reactions, making it a potential candidate for applications in pharmaceuticals and biochemistry. The presence of both functional groups allows it to act as a building block in peptide synthesis or as a ligand in coordination chemistry. Overall, (1S,3R)-3-Aminocyclopentanecarboxylic acid is of interest in research fields exploring amino acid derivatives and their roles in biological systems.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5+/m0/s1
InChI key:InChIKey=MLLSSTJTARJLHK-CRCLSJGQSA-N
SMILES:C(O)(=O)[C@@H]1C[C@H](N)CC1
Synonyms:- (+)-(1R,3S)-1-amino-cyclopent-2-ene-4-carboxylic acid
- (+)-cis-3-Aminocyclopentanecarboxylic acid
- (1S,3R)-3-Aminocyclopentane-1-carboxylic acid
- Cyclopentanecarboxylic acid, 3-amino-, (1S,3R)-
- Cyclopentanecarboxylic acid, 3-amino-, (1S-cis)-
- L-AcPAC
- (+)-(1S,3R)-3-Aminocyclopentanecarboxylic acid
- (1S,3R)-3-Aminocyclopentanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(1S,3R)-(+)-3-Aminocyclopentanecarboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H11NO2Purity:95%Molecular weight:129.16(1S,3R)-3-Aminocyclopentanecarboxylic acid
CAS:Formula:C6H11NO2Purity:98%Color and Shape:SolidMolecular weight:129.1570(1S,3R)-3-Aminocyclopentanecarboxylic acid
CAS:(1S,3R)-3-Aminocyclopentanecarboxylic acidFormula:C6H11NO2Purity:98%Molecular weight:129.16(1S,3R)-3-Aminocyclopentane carboxylic acid
CAS:(1S,3R)-3-Aminocyclopentane carboxylic acid exhibits activity on GABAA receptors.Formula:C6H11NO2Color and Shape:SolidMolecular weight:129.16(1S,3R)-3-Aminocyclopentane carboxylic acid
CAS:(1S,3R)-3-Aminocyclopentanecarboxylic acidFormula:C6H11NO2Purity:98%Molecular weight:129.16(+)-(1S,3R)-3-Amino-cyclopentane carboxylic acid
CAS:The nature of the amino acid side chain plays a major role in determining the properties of an amino acid. The side chain is either hydrophobic (CH3) or hydrophilic (NH2). Amino acids are arranged into subunits. The alpha-amino group is attached to the carbon atom at the end of the side chain, and the carboxyl group is attached to a second carbon atom on a different molecule. These two molecules are joined by a chemical bond called an amide bond. The alpha-carboxyl group determines whether an amino acid will be acidic or basic in nature. The pH scale ranges from 0 to 14, with 7 being neutral, and numbers higher than 7 indicating alkaline conditions. Constant values for each amino acid can be found on this website:
Formula:C6H11NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:129.16 g/mol(1S,3R)-3-Aminocyclopentanecarboxylic acid
CAS:Formula:C6H11NO2Purity:98%Color and Shape:SolidMolecular weight:129.159






