CAS 72002-30-3

(2R)-6-oxopiperidine-2-carboxylic acid

Description:

(2R)-6-oxopiperidine-2-carboxylic acid, also known as a derivative of piperidine, is characterized by its cyclic structure featuring a six-membered ring containing nitrogen. The presence of a carboxylic acid group (-COOH) and a ketone group (C=O) contributes to its reactivity and solubility in polar solvents. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with a moderate melting point. It is often used in organic synthesis and medicinal chemistry due to its potential as a building block for various pharmaceuticals. The stereochemistry indicated by the (2R) designation suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. Additionally, its molecular structure allows for hydrogen bonding, which can enhance its solubility in aqueous environments. Overall, (2R)-6-oxopiperidine-2-carboxylic acid is a versatile compound with applications in research and development within the chemical and pharmaceutical industries.

Formula: C₆H₉NO₃

InChI: InChI=1/C6H9NO3/c8-5-3-1-2-4(7-5)6(9)10/h4H,1-3H2,(H,7,8)(H,9,10)/t4-/m1/s1

SMILES: C1C[C@H](C(=O)O)N=C(C1)O

Synonyms:

• 2-Piperidinecarboxylic acid, 6-oxo-, (2R)-
• (R)-6-Oxo-piperidine-2-carboxylic acid

(R)-6-Oxopiperidine-2-carboxylic acid

CAS: 72002-30-3

Formula: C₆H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.1406

Ref: IN-DA005EBF

(R)-6-Oxopiperidine-2-carboxylic acid

CAS: 72002-30-3

(R)-6-Oxopiperidine-2-carboxylic acid

Purity: 98%

Molecular weight: 143.14g/mol

Ref: 54-OR92199

D-6-Oxo-pipecolinic acid

CAS: 72002-30-3

Formula: C₆H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.142

Ref: 10-F040124

D-Pyrohomoglutamic Acid

CAS: 72002-30-3

D-Pyrohomoglutamic acid: used in LMP2 inhibitors synthesis and in substance P peptide analogs.

Formula: C₆H₉NO₃

Color and Shape: Solid

Molecular weight: 143.14

Ref: TM-T71769