CAS 7336-54-1
:N-(5-bromothiazol-2-yl)acetamide
Description:
N-(5-bromothiazol-2-yl)acetamide is a chemical compound characterized by its thiazole ring, which contains a bromine substituent at the 5-position. This compound features an acetamide functional group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide group. The thiazole moiety is known for its biological activity, often being involved in various pharmacological applications, including antimicrobial and anticancer properties. The bromine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, N-(5-bromothiazol-2-yl)acetamide may undergo various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a significant interest in medicinal chemistry and material science.
Formula:C5H5BrN2OS
InChI:InChI=1/C5H5BrN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9)
SMILES:CC(=Nc1ncc(Br)s1)O
Synonyms:- 2-Acetamido-5-Bromothiazole
- N-(5-bromo-1,3-thiazol-2-yl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Acetamido-5-bromo-1,3-thiazole
CAS:2-Acetamido-5-bromo-1,3-thiazoleFormula:C5H5BrN2OSPurity:≥95%Color and Shape:SolidMolecular weight:221.0752-Acetamido-5-bromothiazole
CAS:Formula:C5H5BrN2OSPurity:97%Color and Shape:SolidMolecular weight:221.07502-Acetamido-5-bromothiazole
CAS:2-Acetamido-5-bromothiazole is an anion that can be synthesized from acetamide and bromoacetaldehyde. It reacts with amines to form amidine salts, which are used as activating agents. 2-Acetamido-5-bromothiazole has a heteroaromatic ring structure and can react with nucleophiles to produce substitution products. The nitration of 2-acetamido-5-bromothiazole yields 2,6-dinitrobenzotriazole, which is used in the production of dyes and explosives. 2-Acetamido-5-bromothiazole can also be synthesized into alkoxides by reacting it with potassium hydroxide or sodium hydroxide. This compound has a neutral charge due to the presence of its conjugate acid H2O and conjugate base NH3.
Formula:C5H5BrN2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:221.08 g/mol2-Acetamido-5-bromothiazole
CAS:Formula:C5H5BrN2OSPurity:97%Color and Shape:SolidMolecular weight:221.07N-(5-bromothiazol-2-yl)acetamide
CAS:N-(5-bromothiazol-2-yl)acetamideFormula:C5H5BrN2OSPurity:98%Molecular weight:221.08




