CAS 73893-35-3
:1,1,1-trifluoro-4,4-dimethoxy-2-methylbutan-2-ol
Description:
1,1,1-Trifluoro-4,4-dimethoxy-2-methylbutan-2-ol, with CAS number 73893-35-3, is a fluorinated organic compound characterized by the presence of three fluorine atoms, two methoxy groups, and a tertiary alcohol functional group. This compound typically exhibits a high degree of polarity due to the electronegative fluorine atoms and the hydroxyl group, which can influence its solubility in various solvents. The trifluoromethyl group often imparts unique chemical reactivity and stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. The methoxy groups contribute to its overall hydrophobic character while also providing potential sites for further chemical modification. Additionally, the presence of the tertiary alcohol suggests that it may participate in hydrogen bonding, affecting its boiling point and other physical properties. Overall, this compound's unique structure and functional groups make it a valuable subject of study in organic chemistry and materials science.
Formula:C7H13F3O3
InChI:InChI=1/C7H13F3O3/c1-6(11,7(8,9)10)4-5(12-2)13-3/h5,11H,4H2,1-3H3
SMILES:CC(CC(OC)OC)(C(F)(F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.